Products 83719-41-9
CAS 83719-41-9 appears in our catalog under these names: 4-Methyl-d3-catechol, 4-Methyl-d3-catechol, 97 atom % D, min 98% Chemical Purity, 4-Methylcatechol-d3, 98.4%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 1 mg, 5 mg, 10 mg.
4-(trideuteriomethyl)benzene-1,2-diol (CAS 83719-41-9) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 127.16 g/mol. IUPAC name: 4-(trideuteriomethyl)benzene-1,2-diol. InChIKey: ZBCATMYQYDCTIZ-FIBGUPNXSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 127.16 g/mol |
| IUPAC name | 4-(trideuteriomethyl)benzene-1,2-diol |
| InChIKey | ZBCATMYQYDCTIZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)