CAS 83732-66-5 is the registry number for Sodium 4,6-Dihydroxynaphthalene-2-sulfonate, 80%, 80%. Offered by: Chemat. Available pack sizes: 1g.
Sodium 4,6-dihydroxynaphthalene-2-sulfonate (CAS 83732-66-5) is a chemical compound with the molecular formula C10H7NaO5S and a molecular weight of 262.22 g/mol. IUPAC name: sodium 4,6-dihydroxynaphthalene-2-sulfonate. InChIKey: KJIKTXVDOGQVIJ-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO5S |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | sodium 4,6-dihydroxynaphthalene-2-sulfonate |
| InChIKey | KJIKTXVDOGQVIJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)[O-])O)O.[Na+] |
Computed by PubChem (NCBI)