Products 83741-76-8
CAS 83741-76-8 appears in our catalog under these names: Pentanoic-5,5,5-d3 Acid, >95% (GC), Pentanoic-5,5,5-d3 Acid, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 50mg, 0,5g, 0,25g.
5,5,5-trideuteriopentanoic acid (CAS 83741-76-8) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 105.15 g/mol. IUPAC name: 5,5,5-trideuteriopentanoic acid. InChIKey: NQPDZGIKBAWPEJ-FIBGUPNXSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 105.15 g/mol |
| IUPAC name | 5,5,5-trideuteriopentanoic acid |
| InChIKey | NQPDZGIKBAWPEJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5,5,5-trideuteriopentanoic acid, orb3138840