CAS 83749-78-4 is the registry number for 1-Chloro-4-phenyl-5h-pyridazino[4,5-b]indole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-chloro-4-phenyl-5H-pyridazino[4,5-b]indole (CAS 83749-78-4) is a chemical compound with the molecular formula C16H10ClN3 and a molecular weight of 279.72 g/mol. IUPAC name: 1-chloro-4-phenyl-5H-pyridazino[4,5-b]indole. InChIKey: JUHUUGUZXMXYKV-UHFFFAOYSA-N.
| Molecular formula | C16H10ClN3 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 1-chloro-4-phenyl-5H-pyridazino[4,5-b]indole |
| InChIKey | JUHUUGUZXMXYKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(C3=C2NC4=CC=CC=C43)Cl |
Computed by PubChem (NCBI)