CAS 83785-12-0 is the registry number for Dimethyl 2,2'-[(2-nitro-1,4-phenylene)bis(oxy)]diacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenoxy]acetate (CAS 83785-12-0) is a chemical compound with the molecular formula C12H13NO8 and a molecular weight of 299.23 g/mol. IUPAC name: methyl 2-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenoxy]acetate. InChIKey: VKSRMFSVFZGLSP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO8 |
|---|---|
| Molecular weight | 299.23 g/mol |
| IUPAC name | methyl 2-[4-(2-methoxy-2-oxoethoxy)-3-nitrophenoxy]acetate |
| InChIKey | VKSRMFSVFZGLSP-UHFFFAOYSA-N |
| SMILES | COC(=O)COC1=CC(=C(C=C1)OCC(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)