CAS 83792-47-6 appears in our catalog under these names: Fmoc–Arg(Tos)–OH, FMoc-Arg(Tos)-OH/ 98.85% (existing batch purity), Fmoc-L-Arg(Tos)-OH, Fmoc-Arg(Tos)-OH 98%, Fmoc-Arg(Tos)-OH, 98%, 98%. Offered by: GLPBio, TargetMol, Iris Biotech, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 10 g, 25 g, 100 g.
(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 83792-47-6) is a chemical compound with the molecular formula C28H30N4O6S and a molecular weight of 550.6 g/mol. IUPAC name: (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: JRRARHJPRLAGNT-VWLOTQADSA-N.
| Molecular formula | C28H30N4O6S |
|---|---|
| Molecular weight | 550.6 g/mol |
| IUPAC name | (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | JRRARHJPRLAGNT-VWLOTQADSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)N |
Computed by PubChem (NCBI)