Products 838-30-2
CAS 838-30-2 is the registry number for 1-Benzyl-5-fluoro-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-benzyl-5-fluoroindole (CAS 838-30-2) is a chemical compound with the molecular formula C15H12FN and a molecular weight of 225.26 g/mol. IUPAC name: 1-benzyl-5-fluoroindole. InChIKey: QZIAUKPDFYALKI-UHFFFAOYSA-N.
| Molecular formula | C15H12FN |
|---|---|
| Molecular weight | 225.26 g/mol |
| IUPAC name | 1-benzyl-5-fluoroindole |
| InChIKey | QZIAUKPDFYALKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=C2C=CC(=C3)F |
Computed by PubChem (NCBI)