Products 838264-00-9
CAS 838264-00-9 is the registry number for 3-Bromo-5-ethoxy-4-isobutoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-bromo-5-ethoxy-4-(2-methylpropoxy)benzoic acid (CAS 838264-00-9) is a chemical compound with the molecular formula C13H17BrO4 and a molecular weight of 317.17 g/mol. IUPAC name: 3-bromo-5-ethoxy-4-(2-methylpropoxy)benzoic acid. InChIKey: CARBXQOFVILFDV-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO4 |
|---|---|
| Molecular weight | 317.17 g/mol |
| IUPAC name | 3-bromo-5-ethoxy-4-(2-methylpropoxy)benzoic acid |
| InChIKey | CARBXQOFVILFDV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C(=O)O)Br)OCC(C)C |
Computed by PubChem (NCBI)