CAS 83851-38-1 appears in our catalog under these names: Leukotriene A3 methyl ester, Leukotriene A3 methyl ester, Leukotriene A 3 methyl ester. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25ug, 100μg, 25μg, 50μg, 1mg, Get quote.
Methyl 4-[(2S,3S)-3-[(1E,3E)-tetradeca-1,3,5-trienyl]oxiran-2-yl]butanoate (CAS 83851-38-1) is a chemical compound with the molecular formula C21H34O3 and a molecular weight of 334.5 g/mol. IUPAC name: methyl 4-[(2S,3S)-3-[(1E,3E)-tetradeca-1,3,5-trienyl]oxiran-2-yl]butanoate. InChIKey: YOAQIJHBMIIBJM-CZVBCWTGSA-N.
| Molecular formula | C21H34O3 |
|---|---|
| Molecular weight | 334.5 g/mol |
| IUPAC name | methyl 4-[(2S,3S)-3-[(1E,3E)-tetradeca-1,3,5-trienyl]oxiran-2-yl]butanoate |
| InChIKey | YOAQIJHBMIIBJM-CZVBCWTGSA-N |
| SMILES | CCCCCCCCC=C/C=C/C=C/[C@H]1[C@@H](O1)CCCC(=O)OC |
Computed by PubChem (NCBI)