CAS 83863-63-2 appears in our catalog under these names: Dibenzofuran-2-sulfonic acid, 95%, Dibenzofuran-2-sulfonic acid hydrate, 95%, Dibenzo(b,d)furan-2-sulfonic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 250mg, 25mg, 50mg.
Dibenzofuran-2-sulfonic acid (CAS 83863-63-2) is a chemical compound with the molecular formula C12H8O4S and a molecular weight of 248.26 g/mol. IUPAC name: dibenzofuran-2-sulfonic acid. InChIKey: JANFYPHFIPGYTQ-UHFFFAOYSA-N.
| Molecular formula | C12H8O4S |
|---|---|
| Molecular weight | 248.26 g/mol |
| IUPAC name | dibenzofuran-2-sulfonic acid |
| InChIKey | JANFYPHFIPGYTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)S(=O)(=O)O |
Computed by PubChem (NCBI)