CAS 83881-48-5 appears in our catalog under these names: Cetirizine Methyl Ester Dihydrochloride (>90%), Methyl Ester of Cetirizine Dihydrochloride, Cetirizine methyl ester dihydrochloride, CETIRIZINE HYDROCHLORIDE METHYL ESTER. Offered by: TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 500mg, 50mg, 100mg, 10mg, 5mg, 25mg.
Methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate;dihydrochloride (CAS 83881-48-5) is a chemical compound with the molecular formula C22H29Cl3N2O3 and a molecular weight of 475.8 g/mol. IUPAC name: methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate;dihydrochloride. InChIKey: VJPNCOBMAJDZSG-UHFFFAOYSA-N.
| Molecular formula | C22H29Cl3N2O3 |
|---|---|
| Molecular weight | 475.8 g/mol |
| IUPAC name | methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate;dihydrochloride |
| InChIKey | VJPNCOBMAJDZSG-UHFFFAOYSA-N |
| SMILES | COC(=O)COCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
Computed by PubChem (NCBI)