CAS 83916-89-6 appears in our catalog under these names: Methyl 2,3,4-Tri-O-benzyl-L-rhamnopyranoside, 98%, Methyl 2,3,4-tri-O-benzyl-L-rhamnopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg, 250mg.
(3R,4R,5S,6S)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxane (CAS 83916-89-6) is a chemical compound with the molecular formula C28H32O5 and a molecular weight of 448.5 g/mol. IUPAC name: (3R,4R,5S,6S)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxane. InChIKey: QTDLREJYMFIJBR-VUUHZGGKSA-N.
| Molecular formula | C28H32O5 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | (3R,4R,5S,6S)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
| InChIKey | QTDLREJYMFIJBR-VUUHZGGKSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H](C(O1)OC)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)