CAS 83918-60-9 appears in our catalog under these names: Fumaric Acid Monoethyl Ester Magnesium Salt (2:1), Monoethyl Fumarate Magnesium, Magnesium (E)–4–ethoxy–4–oxobut–2–enoate, 2-Butenedioic acid (2E)-, 1-ethyl ester, magnesium salt (2:1), ≥95%, ≥95%. Offered by: TRC, Mikromol, LoGiCal, GLPBio, Chemat. Available pack sizes: 500mg, 250mg, 10mg, 100mg, 1g, 5g.
Magnesium bis((E)-4-ethoxy-4-oxobut-2-enoate) (CAS 83918-60-9) is a chemical compound with the molecular formula C12H14MgO8 and a molecular weight of 310.54 g/mol. IUPAC name: magnesium bis((E)-4-ethoxy-4-oxobut-2-enoate). InChIKey: ZHLRSUSHKGQBNV-SYWGCQIGSA-L.
| Molecular formula | C12H14MgO8 |
|---|---|
| Molecular weight | 310.54 g/mol |
| IUPAC name | magnesium bis((E)-4-ethoxy-4-oxobut-2-enoate) |
| InChIKey | ZHLRSUSHKGQBNV-SYWGCQIGSA-L |
| SMILES | CCOC(=O)/C=C/C(=O)[O-].CCOC(=O)/C=C/C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)