Products 83920-54-1
CAS 83920-54-1 is the registry number for Theophylline (L-lysine). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2,6-diaminohexanoic acid;1,3-dimethyl-7H-purine-2,6-dione (CAS 83920-54-1) is a chemical compound with the molecular formula C13H22N6O4 and a molecular weight of 326.35 g/mol. IUPAC name: (2S)-2,6-diaminohexanoic acid;1,3-dimethyl-7H-purine-2,6-dione. InChIKey: UBLVUWUKNHKCJJ-ZSCHJXSPSA-N.
| Molecular formula | C13H22N6O4 |
|---|---|
| Molecular weight | 326.35 g/mol |
| IUPAC name | (2S)-2,6-diaminohexanoic acid;1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | UBLVUWUKNHKCJJ-ZSCHJXSPSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CCN)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Lysine theophylline, Lysine theophyllinate, Paidomal, Theophylline lysine, (2S)-2,6-diaminohexanoic acid;1,3-dimethyl-7H-purine-2,6-dione, THEOPHYLLINE LYSINE SALT, orb1696234, THEOPHYLLINE LYSINE [WHO-DD], THEOPHYLLINE LYSINE SALT [MI], L-Lysine--1,3-dimethyl-3,9-dihydro-1H-purine-2,6-dione (1/1)