CAS 839712-15-1 appears in our catalog under these names: Cariprazine Impurity 16, Cariprazine Impurity 3, Desmethyl Cariprazine, >95% (HPLC), Desmethyl cariprazine, Desmethyl cariprazine. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 5mg, 25mg, 50mg, 100 mg.
1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-3-methylurea (CAS 839712-15-1) is a chemical compound with the molecular formula C20H30Cl2N4O and a molecular weight of 413.4 g/mol. IUPAC name: 1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-3-methylurea. InChIKey: WMQLLTKSISGWHQ-UHFFFAOYSA-N.
| Molecular formula | C20H30Cl2N4O |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-3-methylurea |
| InChIKey | WMQLLTKSISGWHQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)NC1CCC(CC1)CCN2CCN(CC2)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)