CAS 83972-01-4 appears in our catalog under these names: Magnesium 4-Nitrobenzyl Malonate, Magnesium mono-p-nitrobenzyl malonate, 95%, Magnesium mono–p–nitrobenzyl malonate, Magnesium mono-p-nitrobenzyl malonate, 99%+,RG, 99%+,RG. Offered by: TCI, Combi-blocks, GLPBio, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Magnesium bis(3-[(4-nitrophenyl)methoxy]-3-oxopropanoate) (CAS 83972-01-4) is a chemical compound with the molecular formula C20H16MgN2O12 and a molecular weight of 500.7 g/mol. IUPAC name: magnesium bis(3-[(4-nitrophenyl)methoxy]-3-oxopropanoate). InChIKey: WAFDWKYNSTVECG-UHFFFAOYSA-L.
| Molecular formula | C20H16MgN2O12 |
|---|---|
| Molecular weight | 500.7 g/mol |
| IUPAC name | magnesium bis(3-[(4-nitrophenyl)methoxy]-3-oxopropanoate) |
| InChIKey | WAFDWKYNSTVECG-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1COC(=O)CC(=O)[O-])[N+](=O)[O-].C1=CC(=CC=C1COC(=O)CC(=O)[O-])[N+](=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)