CAS 839722-07-5 appears in our catalog under these names: Chloro(1,3–bis(t–butyl)–2H–imidazol–2–ylidene)gold(I), Chloro[1,3-bis(1,1'-dimethylethyl)2H-imidazol-2-ylidene]gold(I), 98%, 98%, Chloro[1,3-bis(1,1'-dimethylethyl)2H-imidazol-2-ylidene]gold(I), 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Chloro-(1,3-ditert-butylimidazol-2-ylidene)gold (CAS 839722-07-5) is a chemical compound with the molecular formula C11H20AuClN2 and a molecular weight of 412.71 g/mol. IUPAC name: chloro-(1,3-ditert-butylimidazol-2-ylidene)gold. InChIKey: OZAGJDJSGBJLSH-UHFFFAOYSA-M.
| Molecular formula | C11H20AuClN2 |
|---|---|
| Molecular weight | 412.71 g/mol |
| IUPAC name | chloro-(1,3-ditert-butylimidazol-2-ylidene)gold |
| InChIKey | OZAGJDJSGBJLSH-UHFFFAOYSA-M |
| SMILES | CC(C)(C)N1C=CN(C1=[Au]Cl)C(C)(C)C |
Computed by PubChem (NCBI)