CAS 839726-94-2 is the registry number for (2E)-3-(Dimethylamino)-1-(4-ethoxyphenyl)prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(dimethylamino)-1-(4-ethoxyphenyl)prop-2-en-1-one (CAS 839726-94-2) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(4-ethoxyphenyl)prop-2-en-1-one. InChIKey: CRMJUFYPWLQANL-MDZDMXLPSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(4-ethoxyphenyl)prop-2-en-1-one |
| InChIKey | CRMJUFYPWLQANL-MDZDMXLPSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)/C=C/N(C)C |
Computed by PubChem (NCBI)