CAS 83993-82-2 is the registry number for 4-(4-Nitrophenyl)-2,6-diphenylpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-nitrophenyl)-2,6-diphenylpyridine (CAS 83993-82-2) is a chemical compound with the molecular formula C23H16N2O2 and a molecular weight of 352.4 g/mol. IUPAC name: 4-(4-nitrophenyl)-2,6-diphenylpyridine. InChIKey: DUUHRLJSNIXIHI-UHFFFAOYSA-N.
| Molecular formula | C23H16N2O2 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-2,6-diphenylpyridine |
| InChIKey | DUUHRLJSNIXIHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)