CAS 84-81-1 appears in our catalog under these names: Menaquinone 6, 1 mg, Menaquinone 6, VITAMIN K2, Menaquinone 6 98% (NMR), Menaquinone 6, 98%, 98%. Offered by: Roth, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 1mg, on request, 25mg, 5mg, 2mg, 10mg, 50mg, 100mg.
2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-3-methylnaphthalene-1,4-dione (CAS 84-81-1) is a chemical compound with the molecular formula C41H56O2 and a molecular weight of 580.9 g/mol. IUPAC name: 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-3-methylnaphthalene-1,4-dione. InChIKey: PFRQBZFETXBLTP-RCIYGOBDSA-N.
| Molecular formula | C41H56O2 |
|---|---|
| Molecular weight | 580.9 g/mol |
| IUPAC name | 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-3-methylnaphthalene-1,4-dione |
| InChIKey | PFRQBZFETXBLTP-RCIYGOBDSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)