CAS 84009-23-4 is the registry number for 2-Furancarboxylic acid, copper complex, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(furan-2-carboxylate) (CAS 84009-23-4) is a chemical compound with the molecular formula C10H6CuO6 and a molecular weight of 285.70 g/mol. IUPAC name: copper bis(furan-2-carboxylate). InChIKey: OBSQZDSQVQLRQZ-UHFFFAOYSA-L.
| Molecular formula | C10H6CuO6 |
|---|---|
| Molecular weight | 285.70 g/mol |
| IUPAC name | copper bis(furan-2-carboxylate) |
| InChIKey | OBSQZDSQVQLRQZ-UHFFFAOYSA-L |
| SMILES | C1=COC(=C1)C(=O)[O-].C1=COC(=C1)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)