Products 840474-95-5
CAS 840474-95-5 is the registry number for AJM 290. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-(benzenesulfonyl)-6-fluoroindol-2-yl]-4-hydroxycyclohexa-2,5-dien-1-one (CAS 840474-95-5) is a chemical compound with the molecular formula C20H14FNO4S and a molecular weight of 383.4 g/mol. IUPAC name: 4-[1-(benzenesulfonyl)-6-fluoroindol-2-yl]-4-hydroxycyclohexa-2,5-dien-1-one. InChIKey: NUKLBNRXGJLHIA-UHFFFAOYSA-N.
| Molecular formula | C20H14FNO4S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 4-[1-(benzenesulfonyl)-6-fluoroindol-2-yl]-4-hydroxycyclohexa-2,5-dien-1-one |
| InChIKey | NUKLBNRXGJLHIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2C=C(C=C3)F)C4(C=CC(=O)C=C4)O |
Computed by PubChem (NCBI)