CAS 840493-84-7 appears in our catalog under these names: N-(5-Bromothiazol-2-yl)pivalamide, 95+%, N-(5-Bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanamide (CAS 840493-84-7) is a chemical compound with the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. IUPAC name: N-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanamide. InChIKey: YXGIOMZEOSAJJU-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2OS |
|---|---|
| Molecular weight | 263.16 g/mol |
| IUPAC name | N-(5-bromo-1,3-thiazol-2-yl)-2,2-dimethylpropanamide |
| InChIKey | YXGIOMZEOSAJJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(S1)Br |
Computed by PubChem (NCBI)