Products 84053-14-5
CAS 84053-14-5 is the registry number for (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-(4-sulfamoylphenyl)propanoic acid, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-sulfamoylphenyl)propanoic acid (CAS 84053-14-5) is a chemical compound with the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-sulfamoylphenyl)propanoic acid. InChIKey: COMNQBHSVKJFIQ-NSHDSACASA-N.
| Molecular formula | C14H20N2O6S |
|---|---|
| Molecular weight | 344.39 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-sulfamoylphenyl)propanoic acid |
| InChIKey | COMNQBHSVKJFIQ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)