CAS 84077-81-6 appears in our catalog under these names: 2,2–Di(4–tert–octylphenyl)–1–picrylhydrazyl, free radical, 2,2-DI(4-TERT-OCTYLPHENYL)-1-PICRYL-HYDR, 2,2-Di(4-Tert-Octylphenyl)-1-Picrylhydrazyl. Offered by: GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 25mg, 100MG.
CAS 84077-81-6 identifies a chemical compound with the molecular formula C34H44N5O6 and a molecular weight of 618.7 g/mol. InChIKey: CLOCMRDQPYXVKP-UHFFFAOYSA-N.
| Molecular formula | C34H44N5O6 |
|---|---|
| Molecular weight | 618.7 g/mol |
| InChIKey | CLOCMRDQPYXVKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)N(C2=CC=C(C=C2)C(C)(C)CC(C)(C)C)[N]C3=C(C=C(C=C3[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)