CAS 84080-70-6 appears in our catalog under these names: Cefixime Impurity 15, (Z)-4-Chloro-2-((2-methoxy-2-oxoethoxy)imino)-3-oxobutanoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
(2Z)-4-chloro-2-(2-methoxy-2-oxoethoxy)imino-3-oxobutanoic acid (CAS 84080-70-6) is a chemical compound with the molecular formula C7H8ClNO6 and a molecular weight of 237.59 g/mol. IUPAC name: (2Z)-4-chloro-2-(2-methoxy-2-oxoethoxy)imino-3-oxobutanoic acid. InChIKey: VKFHPXSFQRCNQW-TWGQIWQCSA-N.
| Molecular formula | C7H8ClNO6 |
|---|---|
| Molecular weight | 237.59 g/mol |
| IUPAC name | (2Z)-4-chloro-2-(2-methoxy-2-oxoethoxy)imino-3-oxobutanoic acid |
| InChIKey | VKFHPXSFQRCNQW-TWGQIWQCSA-N |
| SMILES | COC(=O)CO/N=C(/C(=O)CCl)\C(=O)O |
Computed by PubChem (NCBI)