CAS 84082-93-9 appears in our catalog under these names: zinc(II) isooctanoate, zinc(II) isooctanoate, Zn: 18%, Zn: 18%. Offered by: GLPBio, Chemat. Available pack sizes: 500g, 100g, 2.5kg.
Zinc bis(6-methylheptanoate) (CAS 84082-93-9) is a chemical compound with the molecular formula C16H30O4Zn and a molecular weight of 351.8 g/mol. IUPAC name: zinc bis(6-methylheptanoate). InChIKey: ADJMNWKZSCQHPS-UHFFFAOYSA-L.
| Molecular formula | C16H30O4Zn |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | zinc bis(6-methylheptanoate) |
| InChIKey | ADJMNWKZSCQHPS-UHFFFAOYSA-L |
| SMILES | CC(C)CCCCC(=O)[O-].CC(C)CCCCC(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)