CAS 841-76-9 is the registry number for TRIPHENYLALUMINUM, 1 M SOLUTION IN DIBU&. Offered by: Sigma-Aldrich. Available pack sizes: 50ML.
Triphenylalumane (CAS 841-76-9) is a chemical compound with the molecular formula C18H15Al and a molecular weight of 258.3 g/mol. IUPAC name: triphenylalumane. InChIKey: JQPMDTQDAXRDGS-UHFFFAOYSA-N.
| Molecular formula | C18H15Al |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | triphenylalumane |
| InChIKey | JQPMDTQDAXRDGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Al](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)