CAS 84100-23-2 appears in our catalog under these names: 4-(tert-Butyl)cyclohexyl acrylate, 97% (stabilized with MEHQ), 4–(tert–Butyl)cyclohexyl acrylate, 4-tert-Butylcyclohexyl Acrylate (cis- and trans- mixture) (stabilized with MEHQ), >92.0%(GC), 4-(tert-Butyl)cyclohexyl acrylate. Offered by: AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 100mg, 25g, 100g, 1g, 5g.
(4-tert-butylcyclohexyl) prop-2-enoate (CAS 84100-23-2) is a chemical compound with the molecular formula C13H22O2 and a molecular weight of 210.31 g/mol. IUPAC name: (4-tert-butylcyclohexyl) prop-2-enoate. InChIKey: LAIJAUHBAWLPCO-UHFFFAOYSA-N.
| Molecular formula | C13H22O2 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | (4-tert-butylcyclohexyl) prop-2-enoate |
| InChIKey | LAIJAUHBAWLPCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(CC1)OC(=O)C=C |
Computed by PubChem (NCBI)