CAS 841208-76-2 is the registry number for 6-(2-Bromoethyl)-1,3-dimethyl-1H-pyrrolo(3,4-d)pyrimidine-2,4(3H,6H)-dione. Offered by: Biosynth. Available pack sizes: 1000mg, 2000mg, 5000mg.
6-(2-bromoethyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione (CAS 841208-76-2) is a chemical compound with the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. IUPAC name: 6-(2-bromoethyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione. InChIKey: CLPWLJZDEOEFFD-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3O2 |
|---|---|
| Molecular weight | 286.13 g/mol |
| IUPAC name | 6-(2-bromoethyl)-1,3-dimethylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| InChIKey | CLPWLJZDEOEFFD-UHFFFAOYSA-N |
| SMILES | CN1C2=CN(C=C2C(=O)N(C1=O)C)CCBr |
Computed by PubChem (NCBI)