CAS 841290-81-1 appears in our catalog under these names: R406, R406/ 98.82% (existing batch purity), R 406, R406 98%, R406, 97.91%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
Benzenesulfonic acid;6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 841290-81-1) is a chemical compound with the molecular formula C28H29FN6O8S and a molecular weight of 628.6 g/mol. IUPAC name: benzenesulfonic acid;6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: UXDRJPYSTZHIOE-UHFFFAOYSA-N.
| Molecular formula | C28H29FN6O8S |
|---|---|
| Molecular weight | 628.6 g/mol |
| IUPAC name | benzenesulfonic acid;6-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | UXDRJPYSTZHIOE-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=N2)NC3=NC(=NC=C3F)NC4=CC(=C(C(=C4)OC)OC)OC)C.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)