CAS 842-15-9 appears in our catalog under these names: 7–Amino–1,3–naphthalenedisulfonic Acid Monopotassium Salt Hydrate, 2-Naphthylamine-6,8-disulfonic acid (potassium), 7-AMINO-1,3-NAPTHALENEDISULPHONIC ACID MONOPOTASSIUM SALT HYDRATE, 90%, Potassium 7-amino-3-sulfonaphthalene-1-sulfonate. Offered by: GLPBio, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 10 g, 5 g, 1 g, 1g, 500g, 5g.
Potassium 7-amino-3-sulfonaphthalene-1-sulfonate (CAS 842-15-9) is a chemical compound with the molecular formula C10H8KNO6S2 and a molecular weight of 341.4 g/mol. IUPAC name: potassium 7-amino-3-sulfonaphthalene-1-sulfonate. InChIKey: GOPRYBNRWIBTIH-UHFFFAOYSA-M.
| Molecular formula | C10H8KNO6S2 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | potassium 7-amino-3-sulfonaphthalene-1-sulfonate |
| InChIKey | GOPRYBNRWIBTIH-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)[O-])N.[K+] |
Computed by PubChem (NCBI)