CAS 842140-53-8 is the registry number for 3-Chloro-4-fluoro-α-(4-methylphenyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-chloro-4-fluorophenyl)-(4-methylphenyl)methanol (CAS 842140-53-8) is a chemical compound with the molecular formula C14H12ClFO and a molecular weight of 250.69 g/mol. IUPAC name: (3-chloro-4-fluorophenyl)-(4-methylphenyl)methanol. InChIKey: DBENVWSWIPQLIT-UHFFFAOYSA-N.
| Molecular formula | C14H12ClFO |
|---|---|
| Molecular weight | 250.69 g/mol |
| IUPAC name | (3-chloro-4-fluorophenyl)-(4-methylphenyl)methanol |
| InChIKey | DBENVWSWIPQLIT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC(=C(C=C2)F)Cl)O |
Computed by PubChem (NCBI)