CAS 84243-24-3 appears in our catalog under these names: 3-Oxo-1-oxa-4,9-diaza-spiro[5.5]undecane-9-carboxylic acid benzyl ester, 90%, Benzyl 3-oxo-1-oxa-4,9-diazaspiro(5.5)undecane-9-carboxylate, 97%, 3-OXO-1-OXA-4,9-DIAZA-SPIRO[5.5]UNDECANE-9-CARBOXYLIC ACID BENZYL ESTER, 97%, 97%, 3-OXO-1-OXA-4,9-DIAZA-SPIRO[5.5]UNDECANE-9-CARBOXYLIC ACID BENZYL ESTER, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
Benzyl 3-oxo-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (CAS 84243-24-3) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 304.34 g/mol. IUPAC name: benzyl 3-oxo-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate. InChIKey: YGJHKLNLYIXWMG-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O4 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | benzyl 3-oxo-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| InChIKey | YGJHKLNLYIXWMG-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CNC(=O)CO2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)