CAS 84246-29-7 appears in our catalog under these names: 1,1,2,2,3,3-Hexafluoropropane-1,3-disulfonimide, 98%, 1,1,2,2,3,3-Hexafluoropropane-1,3-disulfonimide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2g, 10g.
4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide (CAS 84246-29-7) is a chemical compound with the molecular formula C3HF6NO4S2 and a molecular weight of 293.2 g/mol. IUPAC name: 4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide. InChIKey: WOAGDWWRYOZHDS-UHFFFAOYSA-N.
| Molecular formula | C3HF6NO4S2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 4,4,5,5,6,6-hexafluoro-1,3,2-dithiazinane 1,1,3,3-tetraoxide |
| InChIKey | WOAGDWWRYOZHDS-UHFFFAOYSA-N |
| SMILES | C1(C(S(=O)(=O)NS(=O)(=O)C1(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)