CAS 84257-38-5 is the registry number for 4-((2S)-2-Aminopropyl)-N,N,3-trimethylaniline (2R,3R)-2,3-dihydroxybutanedioic acid. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
4-[(2S)-2-aminopropyl]-N,N,3-trimethylaniline;2,3-dihydroxybutanedioic acid (CAS 84257-38-5) is a chemical compound with the molecular formula C16H26N2O6 and a molecular weight of 342.39 g/mol. IUPAC name: 4-[(2S)-2-aminopropyl]-N,N,3-trimethylaniline;2,3-dihydroxybutanedioic acid. InChIKey: UMJOICUHUUJVPC-PPHPATTJSA-N.
| Molecular formula | C16H26N2O6 |
|---|---|
| Molecular weight | 342.39 g/mol |
| IUPAC name | 4-[(2S)-2-aminopropyl]-N,N,3-trimethylaniline;2,3-dihydroxybutanedioic acid |
| InChIKey | UMJOICUHUUJVPC-PPHPATTJSA-N |
| SMILES | CC1=C(C=CC(=C1)N(C)C)C[C@H](C)N.C(C(C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)