CAS 84265-06-5 is the registry number for 1-(4-Formylphenoxy)-N,N-dimethylmethanethioamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
O-(4-formylphenyl) N,N-dimethylcarbamothioate (CAS 84265-06-5) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: O-(4-formylphenyl) N,N-dimethylcarbamothioate. InChIKey: NFZIRYOGSVRUQE-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | O-(4-formylphenyl) N,N-dimethylcarbamothioate |
| InChIKey | NFZIRYOGSVRUQE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)