CAS 84282-10-0 appears in our catalog under these names: 1-(2,4-Dichlorobenzoyl)-2-(1-naphthoyl)hydrazine, 95%, 1-(2,4-Dichlorobenzoyl)-2-(1-naphthoyl)hydrazine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
N'-(2,4-dichlorobenzoyl)naphthalene-1-carbohydrazide (CAS 84282-10-0) is a chemical compound with the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.2 g/mol. IUPAC name: N'-(2,4-dichlorobenzoyl)naphthalene-1-carbohydrazide. InChIKey: DHOBCUSQSGBXCT-UHFFFAOYSA-N.
| Molecular formula | C18H12Cl2N2O2 |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | N'-(2,4-dichlorobenzoyl)naphthalene-1-carbohydrazide |
| InChIKey | DHOBCUSQSGBXCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)NNC(=O)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)