CAS 84294-98-4 is the registry number for DPH propionic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]propanoic acid (CAS 84294-98-4) is a chemical compound with the molecular formula C21H20O2 and a molecular weight of 304.4 g/mol. IUPAC name: 3-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]propanoic acid. InChIKey: SINKVNIAFSCCOS-HOXLXQKJSA-N.
| Molecular formula | C21H20O2 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 3-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]propanoic acid |
| InChIKey | SINKVNIAFSCCOS-HOXLXQKJSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=C(C=C2)CCC(=O)O |
Computed by PubChem (NCBI)