Products 84294-98-4

CAS 84294-98-4 is the registry number for DPH propionic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

3-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]propanoic acid (CAS 84294-98-4) is a chemical compound with the molecular formula C21H20O2 and a molecular weight of 304.4 g/mol. IUPAC name: 3-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]propanoic acid. InChIKey: SINKVNIAFSCCOS-HOXLXQKJSA-N.

Identity
Molecular formulaC21H20O2
Molecular weight304.4 g/mol
IUPAC name3-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]propanoic acid
InChIKeySINKVNIAFSCCOS-HOXLXQKJSA-N
SMILESC1=CC=C(C=C1)/C=C/C=C/C=C/C2=CC=C(C=C2)CCC(=O)O

Computed by PubChem (NCBI)