CAS 843-93-6 appears in our catalog under these names: CP-10447, >95% (HPLC), CP 10447. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
3-(4-bromo-2-methylphenyl)-2-methylquinazolin-4-one (CAS 843-93-6) is a chemical compound with the molecular formula C16H13BrN2O and a molecular weight of 329.19 g/mol. IUPAC name: 3-(4-bromo-2-methylphenyl)-2-methylquinazolin-4-one. InChIKey: CIYGULLCDQXZNK-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2O |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | 3-(4-bromo-2-methylphenyl)-2-methylquinazolin-4-one |
| InChIKey | CIYGULLCDQXZNK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)N2C(=NC3=CC=CC=C3C2=O)C |
Computed by PubChem (NCBI)