CAS 84333-09-5 is the registry number for 5-(2,4-Dichloro-phenoxymethyl)-[1,3,4]thiadiazol-2-ylamine, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
5-[(2,4-dichlorophenoxy)methyl]-1,3,4-thiadiazol-2-amine (CAS 84333-09-5) is a chemical compound with the molecular formula C9H7Cl2N3OS and a molecular weight of 276.14 g/mol. IUPAC name: 5-[(2,4-dichlorophenoxy)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: GTSLKQLOFRYRTJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3OS |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 5-[(2,4-dichlorophenoxy)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | GTSLKQLOFRYRTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC2=NN=C(S2)N |
Computed by PubChem (NCBI)