Products 84344-04-7
CAS 84344-04-7 appears in our catalog under these names: 2-Nitrotoluene-d7, >95% (GC), 2-Nitrotoluene D7, 2-Nitrotoluene-d7, 99 atom % D, min 98% Chemical Purity, D7-2-Nitrotoluene. Offered by: TRC, Dr. Ehrenstorfer, CDN, HPC Standards. Available pack sizes: 500mg, 50mg, 1g, 0,5g, 1x50mg.
1,2,3,4-tetradeuterio-5-nitro-6-(trideuteriomethyl)benzene (CAS 84344-04-7) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 144.18 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-5-nitro-6-(trideuteriomethyl)benzene. InChIKey: PLAZTCDQAHEYBI-AAYPNNLASA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 144.18 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-5-nitro-6-(trideuteriomethyl)benzene |
| InChIKey | PLAZTCDQAHEYBI-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)