Products 843612-34-0

CAS 843612-34-0 is the registry number for rac-(1R,2S)-2-(Propan-2-yl)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Trans-(1R,2S)-2-propan-2-ylcyclopentane-1-carboxylic acid (CAS 843612-34-0) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. IUPAC name: trans-(1R,2S)-2-propan-2-ylcyclopentane-1-carboxylic acid. InChIKey: QIXQEMOUUOKOLL-JGVFFNPUSA-N.

Identity
Molecular formulaC9H16O2
Molecular weight156.22 g/mol
IUPAC nametrans-(1R,2S)-2-propan-2-ylcyclopentane-1-carboxylic acid
InChIKeyQIXQEMOUUOKOLL-JGVFFNPUSA-N
SMILESCC(C)[C@@H]1CCC[C@H]1C(=O)O

Computed by PubChem (NCBI)