CAS 843612-34-0 is the registry number for rac-(1R,2S)-2-(Propan-2-yl)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2S)-2-propan-2-ylcyclopentane-1-carboxylic acid (CAS 843612-34-0) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. IUPAC name: trans-(1R,2S)-2-propan-2-ylcyclopentane-1-carboxylic acid. InChIKey: QIXQEMOUUOKOLL-JGVFFNPUSA-N.
| Molecular formula | C9H16O2 |
|---|---|
| Molecular weight | 156.22 g/mol |
| IUPAC name | trans-(1R,2S)-2-propan-2-ylcyclopentane-1-carboxylic acid |
| InChIKey | QIXQEMOUUOKOLL-JGVFFNPUSA-N |
| SMILES | CC(C)[C@@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)