CAS 84364-89-6 is the registry number for D-Fructose-2,6-diphosphate sodium salt, 95%, 95%. Offered by: Chemat. Available pack sizes: 1mg.
Sodium [(2S,3S,4S,5R)-3,4-dihydroxy-2-phosphonooxy-5-(phosphonooxymethyl)oxolan-2-yl]methanolate (CAS 84364-89-6) is a chemical compound with the molecular formula C6H13NaO12P2 and a molecular weight of 362.10 g/mol. IUPAC name: sodium [(2S,3S,4S,5R)-3,4-dihydroxy-2-phosphonooxy-5-(phosphonooxymethyl)oxolan-2-yl]methanolate. InChIKey: UAGLXYBMOWLLDI-QAYODLCCSA-N.
| Molecular formula | C6H13NaO12P2 |
|---|---|
| Molecular weight | 362.10 g/mol |
| IUPAC name | sodium [(2S,3S,4S,5R)-3,4-dihydroxy-2-phosphonooxy-5-(phosphonooxymethyl)oxolan-2-yl]methanolate |
| InChIKey | UAGLXYBMOWLLDI-QAYODLCCSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@](O1)(C[O-])OP(=O)(O)O)O)O)OP(=O)(O)O.[Na+] |
Computed by PubChem (NCBI)