CAS 84365-55-9 appears in our catalog under these names: (Indenyl)titanium(IV) Trichloride, >98.0%(W)(T), (Indenyl)titanium(IV) Trichloride, 98%, 98%, Trichloro(indenyl)titanium(IV), 98%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
1H-inden-1-ide;trichlorotitanium(1+) (CAS 84365-55-9) is a chemical compound with the molecular formula C9H7Cl3Ti and a molecular weight of 269.4 g/mol. IUPAC name: 1H-inden-1-ide;trichlorotitanium(1+). InChIKey: MDTDQDVMQBTXST-UHFFFAOYSA-K.
| Molecular formula | C9H7Cl3Ti |
|---|---|
| Molecular weight | 269.4 g/mol |
| IUPAC name | 1H-inden-1-ide;trichlorotitanium(1+) |
| InChIKey | MDTDQDVMQBTXST-UHFFFAOYSA-K |
| SMILES | [CH-]1C=CC2=CC=CC=C21.Cl[Ti+](Cl)Cl |
Computed by PubChem (NCBI)