CAS 84377-97-9 is the registry number for Nitromazenil. Offered by: TRC. Available pack sizes: 100mg.
Ethyl 5-methyl-8-nitro-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (CAS 84377-97-9) is a chemical compound with the molecular formula C15H14N4O5 and a molecular weight of 330.30 g/mol. IUPAC name: ethyl 5-methyl-8-nitro-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate. InChIKey: IHISDHNVVJHQPP-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O5 |
|---|---|
| Molecular weight | 330.30 g/mol |
| IUPAC name | ethyl 5-methyl-8-nitro-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| InChIKey | IHISDHNVVJHQPP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC(=C3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)