CAS 84392-07-4 appears in our catalog under these names: 1-Aminocyclopropane-2,2,3,3-d4-carboxylic Acid, 98 atom % D, min 98% Chemical Purity, 1-Aminocyclopropane-1-carboxylic acid-d4, 99.94%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg, 5 mg, 10 mg.
1-amino-2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid (CAS 84392-07-4) is a chemical compound with the molecular formula C4H7NO2 and a molecular weight of 105.13 g/mol. IUPAC name: 1-amino-2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid. InChIKey: PAJPWUMXBYXFCZ-LNLMKGTHSA-N.
| Molecular formula | C4H7NO2 |
|---|---|
| Molecular weight | 105.13 g/mol |
| IUPAC name | 1-amino-2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid |
| InChIKey | PAJPWUMXBYXFCZ-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C1(C(=O)O)N)([2H])[2H])[2H] |
Computed by PubChem (NCBI)