CAS 844-26-8 appears in our catalog under these names: Bithionol sulfoxide, 95%, Bithionol (sulfoxide), 98+%, Bithionol sulfoxide, Bithionol sulfoxide, 98.76% ,, 98.76% ,, Bithionol (sulfoxide), 99.02%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 2g, 50g, 100g.
2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfinylphenol (CAS 844-26-8) is a chemical compound with the molecular formula C12H6Cl4O3S and a molecular weight of 372.0 g/mol. IUPAC name: 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfinylphenol. InChIKey: RPAJWWXZIQJVJF-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4O3S |
|---|---|
| Molecular weight | 372.0 g/mol |
| IUPAC name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfinylphenol |
| InChIKey | RPAJWWXZIQJVJF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1S(=O)C2=C(C(=CC(=C2)Cl)Cl)O)O)Cl)Cl |
Computed by PubChem (NCBI)