Products 844441-29-8
CAS 844441-29-8 is the registry number for LZ9. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2,6-difluorobenzoyl)amino]-N-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (CAS 844441-29-8) is a chemical compound with the molecular formula C17H11F3N4O2 and a molecular weight of 360.29 g/mol. IUPAC name: 4-[(2,6-difluorobenzoyl)amino]-N-(4-fluorophenyl)-1H-pyrazole-5-carboxamide. InChIKey: BDRDBXXWQDFXEC-UHFFFAOYSA-N.
| Molecular formula | C17H11F3N4O2 |
|---|---|
| Molecular weight | 360.29 g/mol |
| IUPAC name | 4-[(2,6-difluorobenzoyl)amino]-N-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| InChIKey | BDRDBXXWQDFXEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC2=C(NN=C2)C(=O)NC3=CC=C(C=C3)F)F |
Computed by PubChem (NCBI)