CAS 84449-65-0 appears in our catalog under these names: 4-(6-((Methylsulfonyl)oxy)benzo[b]thiophen-2-yl)phenyl methanesulfonate, 95%, Raloxifene Impurity 3, 2-(4-Hydroxyphenyl)benzo(b)thiophen-6-ol Bimesylate, 4-(6-((Methylsulfonyl)oxy)benzo(b)thiophen-2-yl)phenyl methanesulfonate, 95+%, 4-(6-Methylsulfonyloxybenzothiophen-2-yl)phenyl Methanesulfonate. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, Mikromol. Available pack sizes: 100mg, 250mg, 5g, 1g, on request, 25mg.
[4-(6-methylsulfonyloxy-1-benzothiophen-2-yl)phenyl] methanesulfonate (CAS 84449-65-0) is a chemical compound with the molecular formula C16H14O6S3 and a molecular weight of 398.5 g/mol. IUPAC name: [4-(6-methylsulfonyloxy-1-benzothiophen-2-yl)phenyl] methanesulfonate. InChIKey: OPKQAMCWGICRGH-UHFFFAOYSA-N.
| Molecular formula | C16H14O6S3 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | [4-(6-methylsulfonyloxy-1-benzothiophen-2-yl)phenyl] methanesulfonate |
| InChIKey | OPKQAMCWGICRGH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC=C(C=C1)C2=CC3=C(S2)C=C(C=C3)OS(=O)(=O)C |
Computed by PubChem (NCBI)